EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O3 |
| Net Charge | 0 |
| Average Mass | 242.274 |
| Monoisotopic Mass | 242.09429 |
| SMILES | [H][C@]1(c2ccc(O)cc2)COc2cc(O)ccc2C1 |
| InChI | InChI=1S/C15H14O3/c16-13-4-1-10(2-5-13)12-7-11-3-6-14(17)8-15(11)18-9-12/h1-6,8,12,16-17H,7,9H2/t12-/m1/s1 |
| InChIKey | ADFCQWZHKCXPAJ-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aus-131 (CHEBI:748719) has role antineoplastic agent (CHEBI:35610) |
| aus-131 (CHEBI:748719) is a hydroxyisoflavans (CHEBI:76250) |
| Synonym | Source |
|---|---|
| Aus-131 | ChEMBL |
| Citations |
|---|