EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21N3O5 |
| Net Charge | 0 |
| Average Mass | 407.426 |
| Monoisotopic Mass | 407.14812 |
| SMILES | CNCCn1c(=O)c2cc(OC)c(OC)cc2c2cnc3cc4c(cc3c21)OCO4 |
| InChI | InChI=1S/C22H21N3O5/c1-23-4-5-25-21-14-8-19-20(30-11-29-19)9-16(14)24-10-15(21)12-6-17(27-2)18(28-3)7-13(12)22(25)26/h6-10,23H,4-5,11H2,1-3H3 |
| InChIKey | BAORCAMWLWRZQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| genz-644282 (CHEBI:748717) has role antineoplastic agent (CHEBI:35610) |
| genz-644282 (CHEBI:748717) is a isoquinolines (CHEBI:24922) |
| Synonym | Source |
|---|---|
| Genz-644282 | ChEMBL |
| Citations |
|---|