EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C46H38Cl2N4.Br |
| Net Charge | 0 |
| Average Mass | 877.552 |
| Monoisotopic Mass | 874.08403 |
| SMILES | CN(c1ccc(Cl)cc1)c1cc[n+](Cc2ccc(-c3ccc(C[n+]4ccc(N(C)c5ccc(Cl)cc5)c5ccccc54)cc3)cc2)c2ccccc12.[Br-].[Br-] |
| InChI | InChI=1S/C46H38Cl2N4.2BrH/c1-49(39-23-19-37(47)20-24-39)43-27-29-51(45-9-5-3-7-41(43)45)31-33-11-15-35(16-12-33)36-17-13-34(14-18-36)32-52-30-28-44(42-8-4-6-10-46(42)52)50(2)40-25-21-38(48)22-26-40;;/h3-30H,31-32H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | DGBVSSXGHKAASQ-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rsm-932a (CHEBI:748715) has role antineoplastic agent (CHEBI:35610) |
| rsm-932a (CHEBI:748715) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| Rsm-932a | ChEMBL |
| RSM 932A | ChEMBL |
| Tcd-717 | ChEMBL |
| Citations |
|---|