EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20Cl2N4O2S |
| Net Charge | 0 |
| Average Mass | 451.379 |
| Monoisotopic Mass | 450.06840 |
| SMILES | CC(C)c1nc(COC(N)=O)n(Cc2ccncc2)c1Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2N4O2S/c1-12(2)18-19(29-16-8-14(21)7-15(22)9-16)26(10-13-3-5-24-6-4-13)17(25-18)11-28-20(23)27/h3-9,12H,10-11H2,1-2H3,(H2,23,27) |
| InChIKey | YQXCVAGCMNFUMQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capravirine (CHEBI:748705) has role anti-HIV agent (CHEBI:64946) |
| capravirine (CHEBI:748705) is a aryl sulfide (CHEBI:35683) |
| INNs | Source |
|---|---|
| capravirina | WHO MedNet |
| capravirine | WHO MedNet |
| Synonym | Source |
|---|---|
| S-1153 | ChEMBL |
| Citations |
|---|