EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Cl.C30H43ClN5O8 |
| Net Charge | 0 |
| Average Mass | 672.607 |
| Monoisotopic Mass | 671.24887 |
| SMILES | COCCOCCOCCOCCOC(=O)OC[n+]1ccc(N/C(=N/C#N)NCCCCCCOc2ccc(Cl)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C30H42ClN5O8.ClH/c1-38-16-17-39-18-19-40-20-21-41-22-23-43-30(37)44-25-36-13-10-27(11-14-36)35-29(34-24-32)33-12-4-2-3-5-15-42-28-8-6-26(31)7-9-28;/h6-11,13-14H,2-5,12,15-23,25H2,1H3,(H,33,34);1H |
| InChIKey | DAHMXVAETAAQOZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| teglarinad chloride (CHEBI:748704) has role antineoplastic agent (CHEBI:35610) |
| teglarinad chloride (CHEBI:748704) is a aromatic ether (CHEBI:35618) |
| INNs | Source |
|---|---|
| chlorure de teglarinad | WHO MedNet |
| cloruro de teglarinad | WHO MedNet |
| teglarinad chloride | WHO MedNet |
| Synonyms | Source |
|---|---|
| EB-1627 | ChEMBL |
| EB1627 | ChEMBL |
| GMX-1777 | ChEMBL |
| GMX1777 | ChEMBL |
| Citations |
|---|