EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15N3O3 |
| Net Charge | 0 |
| Average Mass | 261.281 |
| Monoisotopic Mass | 261.11134 |
| SMILES | N[C@@H](Cc1cnc2ccccc12)C(=O)NCC(=O)O |
| InChI | InChI=1S/C13H15N3O3/c14-10(13(19)16-7-12(17)18)5-8-6-15-11-4-2-1-3-9(8)11/h1-4,6,10,15H,5,7,14H2,(H,16,19)(H,17,18)/t10-/m0/s1 |
| InChIKey | UYKREHOKELZSPB-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Gly (CHEBI:74870) has role metabolite (CHEBI:25212) |
| Trp-Gly (CHEBI:74870) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tryptophylglycine |
| Synonyms | Source |
|---|---|
| N-L-Tryptophylglycine | ChemIDplus |
| L-Trp-Gly | ChEBI |
| tryptophylglycine | ChEBI |
| Tryptophyl-Glycine | HMDB |
| WG | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029083 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:91297 | Reaxys |
| CAS:7360-09-0 | ChemIDplus |