EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748698 - ispronicline
| Formula | C14H22N2O |
| Net Charge | 0 |
| Average Mass | 234.343 |
| Monoisotopic Mass | 234.17321 |
| SMILES | CN[C@@H](C)C/C=C/c1cncc(OC(C)C)c1 |
| InChI | InChI=1S/C14H22N2O/c1-11(2)17-14-8-13(9-16-10-14)7-5-6-12(3)15-4/h5,7-12,15H,6H2,1-4H3/b7-5+/t12-/m0/s1 |
| InChIKey | RPCVIAXDAUMJJP-PZBABLGHSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ispronicline (CHEBI:748698) has role antipsychotic agent (CHEBI:35476) |
| ispronicline (CHEBI:748698) is a chloropyridine (CHEBI:39173) |
| INNs | Source |
|---|---|
| isproniclina | WHO MedNet |
| ispronicline | WHO MedNet |
| Synonyms | Source |
|---|---|
| Azd3480 | ChEMBL |
| AZD-3480 | ChEMBL |
| TC-01734 | ChEMBL |
| TC-1734 | ChEMBL |
| Citations |
|---|