EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748694 - cyclo(prolylglycyl)
| Formula | C7H10N2O2 |
| Net Charge | 0 |
| Average Mass | 154.169 |
| Monoisotopic Mass | 154.07423 |
| SMILES | [H][C@@]12CCCN1C(=O)CNC2=O |
| InChI | InChI=1S/C7H10N2O2/c10-6-4-8-7(11)5-2-1-3-9(5)6/h5H,1-4H2,(H,8,11)/t5-/m0/s1 |
| InChIKey | OWOHLURDBZHNGG-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclo(prolylglycyl) (CHEBI:748694) has role antiviral agent (CHEBI:22587) |
| cyclo(prolylglycyl) (CHEBI:748694) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Cyclic glycine-proline | ChEMBL |
| Cyclo(prolylglycyl) | ChEMBL |
| Na 831 | ChEMBL |
| NA-831 | ChEMBL |
| NA831 | ChEMBL |
| Traneurocin | ChEMBL |
| Citations |
|---|