EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O3 |
| Net Charge | 0 |
| Average Mass | 126.111 |
| Monoisotopic Mass | 126.03169 |
| SMILES | O=Cc1ccc(CO)o1 |
| InChI | InChI=1S/C6H6O3/c7-3-5-1-2-6(4-8)9-5/h1-3,8H,4H2 |
| InChIKey | NOEGNKMFWQHSLB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aes-103 (CHEBI:748690) has role anti-anaemic agent (CHEBI:75835) |
| aes-103 (CHEBI:748690) is a arenecarbaldehyde (CHEBI:33855) |
| Synonyms | Source |
|---|---|
| 5-hydroxymethyl-2-furfuraldehyde | ChEMBL |
| Aes-103 | ChEMBL |
| NSC-40738 | ChEMBL |
| Citations |
|---|