EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3O5 |
| Net Charge | 0 |
| Average Mass | 333.344 |
| Monoisotopic Mass | 333.13247 |
| SMILES | N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H19N3O5/c17-11(7-9-8-18-12-4-2-1-3-10(9)12)15(22)19-13(16(23)24)5-6-14(20)21/h1-4,8,11,13,18H,5-7,17H2,(H,19,22)(H,20,21)(H,23,24)/t11-,13-/m0/s1 |
| InChIKey | PWIQCLSQVQBOQV-AAEUAGOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Glu (CHEBI:74869) has role metabolite (CHEBI:25212) |
| Trp-Glu (CHEBI:74869) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tryptophyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| L-Trp-L-Glu | ChEBI |
| Tryptophyl-Glutamate | ChEBI |
| tryptophylglutamic acid | ChEBI |
| WE | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029082 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4766043 | Reaxys |