EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20FN3O4 |
| Net Charge | 0 |
| Average Mass | 397.406 |
| Monoisotopic Mass | 397.14378 |
| SMILES | O=C(Nc1ccc2nc(O)oc2c1)C(=O)N1CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H20FN3O4/c22-15-3-1-13(2-4-15)11-14-7-9-25(10-8-14)20(27)19(26)23-16-5-6-17-18(12-16)29-21(28)24-17/h1-6,12,14H,7-11H2,(H,23,26)(H,24,28) |
| InChIKey | GKGRZLGAQZPEHO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| radiprodil (CHEBI:748682) has role antispasmodic drug (CHEBI:53784) |
| radiprodil (CHEBI:748682) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| radiprodil | WHO MedNet |
| Synonym | Source |
|---|---|
| RGH-896 | ChEMBL |
| Citations |
|---|