EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C23H32N6O4S |
| Net Charge | 0 |
| Average Mass | 525.075 |
| Monoisotopic Mass | 524.19725 |
| SMILES | CCCc1nc(C)c2c(O)nc(-c3cc(S(=O)(=O)N4CCN(CC)CC4)ccc3OCC)nn12.Cl |
| InChI | InChI=1S/C23H32N6O4S.ClH/c1-5-8-20-24-16(4)21-23(30)25-22(26-29(20)21)18-15-17(9-10-19(18)33-7-3)34(31,32)28-13-11-27(6-2)12-14-28;/h9-10,15H,5-8,11-14H2,1-4H3,(H,25,26,30);1H |
| InChIKey | XCMULUAPJXCOHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vardenafil hydrochloride (CHEBI:748663) has role vasodilator agent (CHEBI:35620) |
| vardenafil hydrochloride (CHEBI:748663) is a sulfonamide (CHEBI:35358) |
| Synonyms | Source |
|---|---|
| BAY 38-9456 | ChEMBL |
| BAY-38-9456 | ChEMBL |
| Nuviva | ChEMBL |
| Vardenafil hydrochloride anhydrous | ChEMBL |
| Vardenafil monohydrochloride | ChEMBL |
| Brand Name | Source |
|---|---|
| Staxyn | ChEMBL |
| Citations |
|---|