EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H24N4O6 |
| Net Charge | 0 |
| Average Mass | 500.511 |
| Monoisotopic Mass | 500.16958 |
| SMILES | Cc1nc(=O)c2c(ccc3ccc(CNc4ccc5c(c4)CN([C@@H](CCC(=O)O)C(=O)O)C5=O)cc32)n1 |
| InChI | InChI=1S/C27H24N4O6/c1-14-29-21-7-4-16-3-2-15(10-20(16)24(21)25(34)30-14)12-28-18-5-6-19-17(11-18)13-31(26(19)35)22(27(36)37)8-9-23(32)33/h2-7,10-11,22,28H,8-9,12-13H2,1H3,(H,32,33)(H,36,37)(H,29,30,34)/t22-/m0/s1 |
| InChIKey | BRVFNEZMTRVUGW-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| osi-7904 (CHEBI:748662) has role antineoplastic agent (CHEBI:35610) |
| osi-7904 (CHEBI:748662) is a glutamic acid derivative (CHEBI:24315) |
| Synonyms | Source |
|---|---|
| BW-1843 | ChEMBL |
| BW1843 | ChEMBL |
| Gs-7904 | ChEMBL |
| GS7904 | ChEMBL |
| Gw-1843 | ChEMBL |
| Osi 7904 | ChEMBL |
| Citations |
|---|