EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748660 - sarcnu
| Formula | C6H11ClN4O3 |
| Net Charge | 0 |
| Average Mass | 222.632 |
| Monoisotopic Mass | 222.05197 |
| SMILES | CN(CC(N)=O)C(=O)N(CCCl)N=O |
| InChI | InChI=1S/C6H11ClN4O3/c1-10(4-5(8)12)6(13)11(9-14)3-2-7/h2-4H2,1H3,(H2,8,12) |
| InChIKey | HYHJFNXFVPGMBI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sarcnu (CHEBI:748660) has role antineoplastic agent (CHEBI:35610) |
| sarcnu (CHEBI:748660) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| 2-[{[(2-chloroethyl)(nitroso)amino]carbonyl}(methyl)amino]acetamide | ChEMBL |
| 2-chloroethyl-3-sarcosinamide-1-nitrosourea | ChEMBL |
| NSC-364432 | ChEMBL |
| Sarcnu | ChEMBL |
| Sarmustine | ChEMBL |
| Citations |
|---|