EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N6O3 |
| Net Charge | 0 |
| Average Mass | 360.418 |
| Monoisotopic Mass | 360.19099 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)[C@@H](N)Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H24N6O3/c18-12(8-10-9-22-13-5-2-1-4-11(10)13)15(24)23-14(16(25)26)6-3-7-21-17(19)20/h1-2,4-5,9,12,14,22H,3,6-8,18H2,(H,23,24)(H,25,26)(H4,19,20,21)/t12-,14-/m0/s1 |
| InChIKey | LCPVBXOHXMBLFW-JSGCOSHPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Arg (CHEBI:74866) has role metabolite (CHEBI:25212) |
| Trp-Arg (CHEBI:74866) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tryptophyl-L-arginine |
| Synonyms | Source |
|---|---|
| WR | ChEBI |
| L-Trp-L-Arg | ChEBI |
| tryptophylarginine | ChEBI |
| Tryptophyl-Arginine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029077 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5776664 | Reaxys |