EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14ClN3O5S2 |
| Net Charge | 0 |
| Average Mass | 307.781 |
| Monoisotopic Mass | 307.00634 |
| SMILES | CNC(=O)N(N(CCCl)S(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C6H14ClN3O5S2/c1-8-6(11)10(17(3,14)15)9(5-4-7)16(2,12)13/h4-5H2,1-3H3,(H,8,11) |
| InChIKey | PVCULFYROUOVGJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laromustine (CHEBI:748656) has role antineoplastic agent (CHEBI:35610) |
| laromustine (CHEBI:748656) is a N-sulfonylurea (CHEBI:76983) |
| INNs | Source |
|---|---|
| laromustina | WHO MedNet |
| laromustine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 101M | ChEMBL |
| Laromustin | ChEMBL |
| NSC-734246 | ChEMBL |
| Onrigin | ChEMBL |
| VNP-40101M | ChEMBL |
| VNP40101M | ChEMBL |
| Brand Name | Source |
|---|---|
| Cloretazine | ChEMBL |
| Citations |
|---|