EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748645 - nebicapone
| Formula | C14H11NO5 |
| Net Charge | 0 |
| Average Mass | 273.244 |
| Monoisotopic Mass | 273.06372 |
| SMILES | O=C(Cc1ccccc1)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11NO5/c16-12(6-9-4-2-1-3-5-9)10-7-11(15(19)20)14(18)13(17)8-10/h1-5,7-8,17-18H,6H2 |
| InChIKey | MRFOLGFFTUGAEB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nebicapone (CHEBI:748645) has role antiparkinson drug (CHEBI:48407) |
| nebicapone (CHEBI:748645) is a stilbenoid (CHEBI:26776) |
| INNs | Source |
|---|---|
| nebicapona | WHO MedNet |
| nebicapone | WHO MedNet |
| Citations |
|---|