EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35N3O |
| Net Charge | 0 |
| Average Mass | 393.575 |
| Monoisotopic Mass | 393.27801 |
| SMILES | [H][C@@]12Cc3cn(C(C)C)c4cccc(c34)[C@@]1([H])C[C@@H](C(=O)NC1CCCCC1)CN2C |
| InChI | InChI=1S/C25H35N3O/c1-16(2)28-15-17-13-23-21(20-10-7-11-22(28)24(17)20)12-18(14-27(23)3)25(29)26-19-8-5-4-6-9-19/h7,10-11,15-16,18-19,21,23H,4-6,8-9,12-14H2,1-3H3,(H,26,29)/t18-,21-,23-/m1/s1 |
| InChIKey | KEMOOQHMCGCZKH-JMUQELJHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amesergide (CHEBI:748639) is a ergoline alkaloid (CHEBI:60529) |
| INNs | Source |
|---|---|
| amesergida | WHO MedNet |
| amesergide | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY-237733 | ChEMBL |
| LY237733 | ChEMBL |
| Citations |
|---|