EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24ClN3O2 |
| Net Charge | 0 |
| Average Mass | 409.917 |
| Monoisotopic Mass | 409.15570 |
| SMILES | O=C1c2ccccc2OC=C(Cl)N1CCCCN1CC=C(c2ccccn2)CC1 |
| InChI | InChI=1S/C23H24ClN3O2/c24-22-17-29-21-9-2-1-7-19(21)23(28)27(22)14-6-5-13-26-15-10-18(11-16-26)20-8-3-4-12-25-20/h1-4,7-10,12,17H,5-6,11,13-16H2 |
| InChIKey | URMTUEWUIGOJBW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piclozotan (CHEBI:748625) has role antiparkinson drug (CHEBI:48407) |
| piclozotan (CHEBI:748625) is a gitoxigenin (CHEBI:38105) |
| piclozotan (CHEBI:748625) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| INN | Source |
|---|---|
| piclozotan | WHO MedNet |
| Synonyms | Source |
|---|---|
| Sun-n4057 | ChEMBL |
| SUN-N-4057 | ChEMBL |
| Citations |
|---|