EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO |
| Net Charge | 0 |
| Average Mass | 123.155 |
| Monoisotopic Mass | 123.06841 |
| SMILES | NCc1ccccc1O |
| InChI | InChI=1S/C7H9NO/c8-5-6-3-1-2-4-7(6)9/h1-4,9H,5,8H2 |
| InChIKey | KPRZOPQOBJRYSW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anticholesteremic drug A substance used to lower plasma cholesterol levels. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(aminomethyl)phenol (CHEBI:748624) has role anti-arrhythmia drug (CHEBI:38070) |
| 2-(aminomethyl)phenol (CHEBI:748624) has role anticholesteremic drug (CHEBI:35821) |
| 2-(aminomethyl)phenol (CHEBI:748624) has role antihypertensive agent (CHEBI:35674) |
| 2-(aminomethyl)phenol (CHEBI:748624) is a phenols (CHEBI:33853) |
| Synonyms | Source |
|---|---|
| 2-aminomethyl-phenol | ChEMBL |
| 2-(aminomethyl)phenol | ChEMBL |
| 2-hoba | ChEMBL |
| 2-hydroxybenzylamine | ChEMBL |
| 2-hydroxylbenzylamine | ChEMBL |
| NSC-127870 | ChEMBL |
| Citations |
|---|