EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H41Cl2N3O2 |
| Net Charge | 0 |
| Average Mass | 606.638 |
| Monoisotopic Mass | 605.25758 |
| SMILES | CC(=O)N(C)C1(c2ccccc2)CCN(CCC[C@]2(c3ccc(Cl)c(Cl)c3)CCCN(C(=O)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C35H41Cl2N3O2/c1-27(41)38(2)35(29-13-7-4-8-14-29)19-23-39(24-20-35)21-9-17-34(30-15-16-31(36)32(37)25-30)18-10-22-40(26-34)33(42)28-11-5-3-6-12-28/h3-8,11-16,25H,9-10,17-24,26H2,1-2H3/t34-/m0/s1 |
| InChIKey | DZOJBGLFWINFBF-UMSFTDKQSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| osanetant (CHEBI:748617) has role antineoplastic agent (CHEBI:35610) |
| osanetant (CHEBI:748617) is a N-acylpiperidine (CHEBI:48591) |
| INN | Source |
|---|---|
| osanetant | WHO MedNet |
| Synonyms | Source |
|---|---|
| SB-236984 | ChEMBL |
| SR-14280 | ChEMBL |
| SR-142801 | ChEMBL |
| SR142801 | ChEMBL |
| Citations |
|---|