EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748605 - cep-7055
| Formula | C32H35N3O4 |
| Net Charge | 0 |
| Average Mass | 525.649 |
| Monoisotopic Mass | 525.26276 |
| SMILES | CC(C)OCc1ccc2c(c1)c1c3c(c4c(c1n2CCCOC(=O)CN(C)C)Cc1ccccc1-4)C(=O)NC3 |
| InChI | InChI=1S/C32H35N3O4/c1-19(2)39-18-20-10-11-26-23(14-20)29-25-16-33-32(37)30(25)28-22-9-6-5-8-21(22)15-24(28)31(29)35(26)12-7-13-38-27(36)17-34(3)4/h5-6,8-11,14,19H,7,12-13,15-18H2,1-4H3,(H,33,37) |
| InChIKey | UHEBDUAFKQHUBV-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cep-7055 (CHEBI:748605) is a organic heterotetracyclic compound (CHEBI:38163) |
| cep-7055 (CHEBI:748605) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| Synonym | Source |
|---|---|
| Cep-7055 | ChEMBL |
| Citations |
|---|