EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20N2O4 |
| Net Charge | 0 |
| Average Mass | 232.280 |
| Monoisotopic Mass | 232.14231 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)[C@@H](C)O)C(=O)O |
| InChI | InChI=1S/C10H20N2O4/c1-5(2)4-7(10(15)16)12-9(14)8(11)6(3)13/h5-8,13H,4,11H2,1-3H3,(H,12,14)(H,15,16)/t6-,7+,8+/m1/s1 |
| InChIKey | BQBCIBCLXBKYHW-CSMHCCOUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Leu (CHEBI:74860) has role metabolite (CHEBI:25212) |
| Thr-Leu (CHEBI:74860) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-threonyl-L-leucine |
| Synonyms | Source |
|---|---|
| L-Thr-L-Leu | ChEBI |
| Threoninyl-Leucine | HMDB |
| threonylleucine | ChEBI |
| TL | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029065 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4251145 | Reaxys |