EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748597 - ly-518674
| Formula | C23H27N3O4 |
| Net Charge | 0 |
| Average Mass | 409.486 |
| Monoisotopic Mass | 409.20016 |
| SMILES | Cc1ccc(Cn2nc(CCCc3ccc(OC(C)(C)C(=O)O)cc3)nc2O)cc1 |
| InChI | InChI=1S/C23H27N3O4/c1-16-7-9-18(10-8-16)15-26-22(29)24-20(25-26)6-4-5-17-11-13-19(14-12-17)30-23(2,3)21(27)28/h7-14H,4-6,15H2,1-3H3,(H,27,28)(H,24,25,29) |
| InChIKey | PNHFDVSKDSLUFH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ly-518674 (CHEBI:748597) has role antihypertensive agent (CHEBI:35674) |
| ly-518674 (CHEBI:748597) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| KB-68984 | ChEMBL |
| Ly-518674 | ChEMBL |
| LY518674 | ChEMBL |
| LY-674 | ChEMBL |
| Citations |
|---|