EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O4 |
| Net Charge | 0 |
| Average Mass | 176.172 |
| Monoisotopic Mass | 176.07971 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C6H12N2O4/c1-3(9)5(7)6(12)8-2-4(10)11/h3,5,9H,2,7H2,1H3,(H,8,12)(H,10,11)/t3-,5+/m1/s1 |
| InChIKey | BIYXEUAFGLTAEM-WUJLRWPWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Gly (CHEBI:74859) has role metabolite (CHEBI:25212) |
| Thr-Gly (CHEBI:74859) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-threonylglycine |
| Synonyms | Source |
|---|---|
| L-Thr-Gly | ChEBI |
| TG | ChEBI |
| Threoninyl-Glycine | HMDB |
| threonylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029061 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4246009 | Reaxys |