EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H29F5O3 |
| Net Charge | 0 |
| Average Mass | 508.527 |
| Monoisotopic Mass | 508.20369 |
| SMILES | [H][C@@]12CC[C@@](O)(C(F)(F)C(F)(F)F)[C@@]1(C)C[C@H](c1ccc(C(C)=O)cc1)C1=C3CCC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C28H29F5O3/c1-15(34)16-3-5-17(6-4-16)22-14-25(2)23(11-12-26(25,36)27(29,30)28(31,32)33)21-9-7-18-13-19(35)8-10-20(18)24(21)22/h3-6,13,21-23,36H,7-12,14H2,1-2H3/t21-,22+,23-,25-,26-/m0/s1 |
| InChIKey | VHZPUDNSVGRVMB-RXDLHWJPSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lonaprisan (CHEBI:748586) has role antineoplastic agent (CHEBI:35610) |
| lonaprisan (CHEBI:748586) is a 3-oxo steroid (CHEBI:47788) |
| INN | Source |
|---|---|
| lonaprisan | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY86-5044 | ChEMBL |
| ZK 230211 | ChEMBL |
| ZK-230211 | ChEMBL |
| ZK230211 | ChEMBL |
| Citations |
|---|