EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748581 - gsk-369796
| Formula | C20H22ClN3O |
| Net Charge | 0 |
| Average Mass | 355.869 |
| Monoisotopic Mass | 355.14514 |
| SMILES | CC(C)(C)NCc1ccc(Nc2ccnc3cc(Cl)ccc23)cc1O |
| InChI | InChI=1S/C20H22ClN3O/c1-20(2,3)23-12-13-4-6-15(11-19(13)25)24-17-8-9-22-18-10-14(21)5-7-16(17)18/h4-11,23,25H,12H2,1-3H3,(H,22,24) |
| InChIKey | ZVMMVSSEAMUNGI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-369796 (CHEBI:748581) has role antimalarial (CHEBI:38068) |
| gsk-369796 (CHEBI:748581) is a organohalogen compound (CHEBI:17792) |
| gsk-369796 (CHEBI:748581) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| BDBM50134936 | ChEMBL |
| CHEMBL147806 | ChEMBL |
| Gsk-369796 | ChEMBL |
| Gsk369796 | ChEMBL |
| GSK 369796 | ChEMBL |
| Ntbisq | ChEMBL |
| Citations |
|---|