EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H46N2O8 |
| Net Charge | 0 |
| Average Mass | 586.726 |
| Monoisotopic Mass | 586.32542 |
| SMILES | [H][C@]12CC3C([C@H]1OC)[C@](O)(C[C@@H]2OC)[C@@]1(O)C2N(CC)C[C@]4(COC(=O)c5ccccc5N)CC[C@H](OC)[C@]32C4[C@@H]1OC |
| InChI | InChI=1S/C32H46N2O8/c1-6-34-15-29(16-42-27(35)17-9-7-8-10-20(17)33)12-11-22(39-3)31-19-13-18-21(38-2)14-30(36,23(19)24(18)40-4)32(37,28(31)34)26(41-5)25(29)31/h7-10,18-19,21-26,28,36-37H,6,11-16,33H2,1-5H3/t18-,19?,21+,22+,23?,24+,25?,26+,28?,29+,30-,31+,32+/m1/s1 |
| InChIKey | NNDHDYDFEDRMGH-ZPGZUGTNSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inuline (CHEBI:748578) is a diterpene alkaloid (CHEBI:23847) |
| Citations |
|---|