EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31N3O2 |
| Net Charge | 0 |
| Average Mass | 369.509 |
| Monoisotopic Mass | 369.24163 |
| SMILES | CCCCN1CCC(CNC(=O)c2c3n(c4ccccc24)CCCO3)CC1 |
| InChI | InChI=1S/C22H31N3O2/c1-2-3-11-24-13-9-17(10-14-24)16-23-21(26)20-18-7-4-5-8-19(18)25-12-6-15-27-22(20)25/h4-5,7-8,17H,2-3,6,9-16H2,1H3,(H,23,26) |
| InChIKey | KVCSJPATKXABRQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piboserod (CHEBI:748574) has role anti-arrhythmia drug (CHEBI:38070) |
| piboserod (CHEBI:748574) has role cardiovascular drug (CHEBI:35554) |
| piboserod (CHEBI:748574) is a indolecarboxamide (CHEBI:46921) |
| INN | Source |
|---|---|
| piboserod | WHO MedNet |
| Synonym | Source |
|---|---|
| SB-207266 | ChEMBL |
| Citations |
|---|