EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O6 |
| Net Charge | 0 |
| Average Mass | 248.235 |
| Monoisotopic Mass | 248.10084 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O6/c1-4(12)7(10)8(15)11-5(9(16)17)2-3-6(13)14/h4-5,7,12H,2-3,10H2,1H3,(H,11,15)(H,13,14)(H,16,17)/t4-,5+,7+/m1/s1 |
| InChIKey | BECPPKYKPSRKCP-ZDLURKLDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Glu (CHEBI:74857) has role metabolite (CHEBI:25212) |
| Thr-Glu (CHEBI:74857) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-threonyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| L-Thr-L-Glu | ChEBI |
| TE | ChEBI |
| Threoninyl-Glutamate | HMDB |
| threonylglutamic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029060 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9569097 | Reaxys |