EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H9BrFNO4 |
| Net Charge | 0 |
| Average Mass | 366.142 |
| Monoisotopic Mass | 364.96990 |
| SMILES | O=C(O)COc1ccc2c(-c3ccccc3F)noc2c1Br |
| InChI | InChI=1S/C15H9BrFNO4/c16-13-11(21-7-12(19)20)6-5-9-14(18-22-15(9)13)8-3-1-2-4-10(8)17/h1-6H,7H2,(H,19,20) |
| InChIKey | QWOLGQYXAQSNAE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brocrinat (CHEBI:748557) is a monocarboxylic acid (CHEBI:25384) |
| INNs | Source |
|---|---|
| brocrinat | WHO MedNet |
| brocrinate | WHO MedNet |
| Synonyms | Source |
|---|---|
| Halocrinic acid | ChEMBL |
| HP 3522 | ChEMBL |
| HP-3522 | ChEMBL |
| HP 522 | ChEMBL |
| HP-522 | ChEMBL |
| P 78 3522 | ChEMBL |
| Citations |
|---|