EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28ClNO6 |
| Net Charge | 0 |
| Average Mass | 401.887 |
| Monoisotopic Mass | 401.16052 |
| SMILES | [H][C@]1([C@@]2(C)O[C@@H]2CC=C(C)C)[C@H](OC)[C@H](OC(=O)NC(=O)CCl)CC[C@]12CO2 |
| InChI | InChI=1S/C19H28ClNO6/c1-11(2)5-6-13-18(3,27-13)16-15(24-4)12(7-8-19(16)10-25-19)26-17(23)21-14(22)9-20/h5,12-13,15-16H,6-10H2,1-4H3,(H,21,22,23)/t12-,13-,15-,16-,18+,19+/m1/s1 |
| InChIKey | MSHZHSPISPJWHW-PVDLLORBSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| o-chloroacetylcarbamoylfumagillol (CHEBI:748550) has role antineoplastic agent (CHEBI:35610) |
| o-chloroacetylcarbamoylfumagillol (CHEBI:748550) is a carbamate ester (CHEBI:23003) |
| Synonym | Source |
|---|---|
| NSC-642492 | ChEMBL |
| Citations |
|---|