EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17N3O5 |
| Net Charge | 0 |
| Average Mass | 247.251 |
| Monoisotopic Mass | 247.11682 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H17N3O5/c1-4(13)7(11)8(15)12-5(9(16)17)2-3-6(10)14/h4-5,7,13H,2-3,11H2,1H3,(H2,10,14)(H,12,15)(H,16,17)/t4-,5+,7+/m1/s1 |
| InChIKey | BWUHENPAEMNGQJ-ZDLURKLDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Gln (CHEBI:74855) has role metabolite (CHEBI:25212) |
| Thr-Gln (CHEBI:74855) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-threonyl-L-glutamine |
| Synonyms | Source |
|---|---|
| L-Thr-L-Gln | ChEBI |
| Threoninyl-Glutamine | HMDB |
| threonylglutamine | ChEBI |
| TQ | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029059 | HMDB |