EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H28N4O11 |
| Net Charge | 0 |
| Average Mass | 608.560 |
| Monoisotopic Mass | 608.17546 |
| SMILES | O=C1c2c(c3c4ccc(O)cc4n([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c3c3nc4cc(O)ccc4c23)C(=O)N1NC(CO)CO |
| InChI | InChI=1S/C29H28N4O11/c34-7-10(8-35)31-33-27(42)20-18-13-3-1-11(37)5-15(13)30-22(18)23-19(21(20)28(33)43)14-4-2-12(38)6-16(14)32(23)29-26(41)25(40)24(39)17(9-36)44-29/h1-6,10,17,24-26,29-31,34-41H,7-9H2/t17-,24-,25+,26-,29-/m1/s1 |
| InChIKey | QMVPQBFHUJZJCS-NTKFZFFISA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edotecarin (CHEBI:748547) has role antineoplastic agent (CHEBI:35610) |
| edotecarin (CHEBI:748547) is a indolocarbazole (CHEBI:51915) |
| INNs | Source |
|---|---|
| edotecarin | WHO MedNet |
| edotecarina | WHO MedNet |
| edotecarine | WHO MedNet |
| Synonyms | Source |
|---|---|
| J-107088 | ChEMBL |
| PF-804950 | ChEMBL |
| Citations |
|---|