EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O6 |
| Net Charge | 0 |
| Average Mass | 234.208 |
| Monoisotopic Mass | 234.08519 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14N2O6/c1-3(11)6(9)7(14)10-4(8(15)16)2-5(12)13/h3-4,6,11H,2,9H2,1H3,(H,10,14)(H,12,13)(H,15,16)/t3-,4+,6+/m1/s1 |
| InChIKey | IOWJRKAVLALBQB-IWGUZYHVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Asp (CHEBI:74854) has role metabolite (CHEBI:25212) |
| Thr-Asp (CHEBI:74854) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-threonyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| L-Thr-L-Asp | ChEBI |
| TD | ChEBI |
| threonylaspartic acid | ChEBI |
| Threoninyl-Aspartate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029057 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:108320-97-4 | ChEBI |