EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N3O |
| Net Charge | 0 |
| Average Mass | 203.245 |
| Monoisotopic Mass | 203.10586 |
| SMILES | CN[C@@H]1Cc2cccc3nc(=O)n(c23)C1 |
| InChI | InChI=1S/C11H13N3O/c1-12-8-5-7-3-2-4-9-10(7)14(6-8)11(15)13-9/h2-4,8,12H,5-6H2,1H3,(H,13,15)/t8-/m1/s1 |
| InChIKey | RKZSNTNMEFVBDT-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sumanirole (CHEBI:748521) has role antiparkinson drug (CHEBI:48407) |
| sumanirole (CHEBI:748521) is a benzimidazoles (CHEBI:22715) |
| INNs | Source |
|---|---|
| sumanirol | WHO MedNet |
| sumanirole | WHO MedNet |
| Synonyms | Source |
|---|---|
| Pnu-95666 | ChEMBL |
| PNU-95666E | ChEMBL |
| Citations |
|---|