EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748515 - censavudine
| Formula | C12H12N2O4 |
| Net Charge | 0 |
| Average Mass | 248.238 |
| Monoisotopic Mass | 248.07971 |
| SMILES | C#C[C@@]1(CO)C=C[C@H](n2cc(C)c(=O)nc2=O)O1 |
| InChI | InChI=1S/C12H12N2O4/c1-3-12(7-15)5-4-9(18-12)14-6-8(2)10(16)13-11(14)17/h1,4-6,9,15H,7H2,2H3,(H,13,16,17)/t9-,12+/m1/s1 |
| InChIKey | OSYWBJSVKUFFSU-SKDRFNHKSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| censavudine (CHEBI:748515) has role anti-HIV agent (CHEBI:64946) |
| censavudine (CHEBI:748515) is a carbohydrate derivative (CHEBI:63299) |
| censavudine (CHEBI:748515) is a nucleobase-containing molecular entity (CHEBI:61120) |
| INNs | Source |
|---|---|
| censavudina | WHO MedNet |
| censavudine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4'-ed4t | ChEMBL |
| 4'-ethynyl stavudine | ChEMBL |
| 4'-ethynylstavudine | ChEMBL |
| BMS-986001 | ChEMBL |
| Censavudine, 4'-ethynyl-d4t | ChEMBL |
| Festinavir | ChEMBL |
| Citations |
|---|