EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20N2O5 |
| Net Charge | 0 |
| Average Mass | 404.422 |
| Monoisotopic Mass | 404.13722 |
| SMILES | CCC(=O)O[C@]1(CC)C(=O)OCc2c1cc1n(c2=O)Cc2cc3ccccc3nc2-1 |
| InChI | InChI=1S/C23H20N2O5/c1-3-19(26)30-23(4-2)16-10-18-20-14(9-13-7-5-6-8-17(13)24-20)11-25(18)21(27)15(16)12-29-22(23)28/h5-10H,3-4,11-12H2,1-2H3/t23-/m0/s1 |
| InChIKey | YCNIQYLWIPCLNY-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| camptothecin-20-o-propionate (CHEBI:748508) has role antineoplastic agent (CHEBI:35610) |
| camptothecin-20-o-propionate (CHEBI:748508) is a pyranoindolizinoquinoline (CHEBI:48626) |
| Synonyms | Source |
|---|---|
| Camptothecin-20-o-propionate | ChEMBL |
| SF-6A | ChEMBL |
| Citations |
|---|