EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24N2O7 |
| Net Charge | 0 |
| Average Mass | 452.463 |
| Monoisotopic Mass | 452.15835 |
| SMILES | COc1cc2c3c(n(CCCNCCO)c(=O)c2cc1OC)-c1cc2c(cc1C3=O)OCO2 |
| InChI | InChI=1S/C24H24N2O7/c1-30-17-8-13-16(11-18(17)31-2)24(29)26(6-3-4-25-5-7-27)22-14-9-19-20(33-12-32-19)10-15(14)23(28)21(13)22/h8-11,25,27H,3-7,12H2,1-2H3 |
| InChIKey | QCSDJDQOJBQTDV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lmp-744 (CHEBI:748506) has role antineoplastic agent (CHEBI:35610) |
| lmp-744 (CHEBI:748506) is a isoquinolines (CHEBI:24922) |
| Synonyms | Source |
|---|---|
| Lmp-744 | ChEMBL |
| Lmp744 | ChEMBL |
| MJ-III-65 | ChEMBL |
| NSC-706743 | ChEMBL |
| NSC-706744 | ChEMBL |
| Topoisomerase-1 inhibitor lmp744 | ChEMBL |
| Citations |
|---|