EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H74N10O14S |
| Net Charge | 0 |
| Average Mass | 1035.232 |
| Monoisotopic Mass | 1034.51067 |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)O)C(C)C)C(C)C |
| InChI | InChI=1S/C47H74N10O14S/c1-8-26(6)36(49)45(68)51-29(18-20-72-7)39(62)52-31(22-35(60)61)42(65)50-28(16-17-34(48)59)40(63)55-37(24(2)3)46(69)57-19-12-15-33(57)44(67)53-30(21-27-13-10-9-11-14-27)41(64)54-32(23-58)43(66)56-38(25(4)5)47(70)71/h9-11,13-14,24-26,28-33,36-38,58H,8,12,15-23,49H2,1-7H3,(H2,48,59)(H,50,65)(H,51,68)(H,52,62)(H,53,67)(H,54,64)(H,55,63)(H,56,66)(H,60,61)(H,70,71)/t26-,28-,29-,30-,31-,32-,33-,36-,37-,38-/m0/s1 |
| InChIKey | BDQMCYCLZBSYJZ-BBXCZNCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| disomotide (CHEBI:748502) has role antineoplastic agent (CHEBI:35610) |
| disomotide (CHEBI:748502) is a polypeptide (CHEBI:15841) |
| INNs | Source |
|---|---|
| disomotida | WHO MedNet |
| disomotide | WHO MedNet |
| Synonyms | Source |
|---|---|
| Gp-100:209-217(210m) peptide | ChEMBL |
| Gp100:209-217(210m) peptide | ChEMBL |
| MPS-22 | ChEMBL |
| Citations |
|---|