EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O4 |
| Net Charge | 0 |
| Average Mass | 460.699 |
| Monoisotopic Mass | 460.35526 |
| SMILES | [H][C@@]12CC[C@]([H])([C@@H](C)OCCCC(O)(CC)CC)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C29H48O4/c1-6-29(32,7-2)16-9-17-33-21(4)25-13-14-26-22(10-8-15-28(25,26)5)11-12-23-18-24(30)19-27(31)20(23)3/h11-12,21,24-27,30-32H,3,6-10,13-19H2,1-2,4-5H3/b22-11+,23-12-/t21-,24-,25-,26+,27+,28-/m1/s1 |
| InChIKey | KLZOTDOJMRMLDX-YBBVPDDNSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lexacalcitol (CHEBI:748501) is a vitamin D (CHEBI:27300) |
| INN | Source |
|---|---|
| lexacalcitol | WHO MedNet |
| Synonyms | Source |
|---|---|
| KH-106 | ChEMBL |
| KH106 | ChEMBL |
| KH-1060 | ChEMBL |
| KH1060 | ChEMBL |
| Citations |
|---|