EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H71N9O14 |
| Net Charge | 0 |
| Average Mass | 974.123 |
| Monoisotopic Mass | 973.51205 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N1CCC[C@H]1C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)C(C)C)[C@@H](C)O)C(C)C |
| InChI | InChI=1S/C46H71N9O14/c1-23(2)20-31(50-39(61)29(47)21-27-12-14-28(57)15-13-27)40(62)49-30(16-17-35(59)60)45(67)55-19-9-10-32(55)41(63)48-22-34(58)54-18-8-11-33(54)42(64)51-36(24(3)4)43(65)53-38(26(7)56)44(66)52-37(25(5)6)46(68)69/h12-15,23-26,29-33,36-38,56-57H,8-11,16-22,47H2,1-7H3,(H,48,63)(H,49,62)(H,50,61)(H,51,64)(H,52,66)(H,53,65)(H,59,60)(H,68,69)/t26-,29+,30+,31+,32+,33+,36+,37+,38+/m1/s1 |
| InChIKey | POVNCJSPYFCWJR-USZUGGBUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ovemotide (CHEBI:748499) has role antineoplastic agent (CHEBI:35610) |
| ovemotide (CHEBI:748499) is a polypeptide (CHEBI:15841) |
| INNs | Source |
|---|---|
| ovemotida | WHO MedNet |
| ovemotide | WHO MedNet |
| Synonyms | Source |
|---|---|
| Elagigiltv | ChEMBL |
| Gp100:280-288(288v) peptide | ChEMBL |
| (leu27)-melan-a, mart 1 (26-35) | ChEMBL |
| Mart-1:26-35(27l) peptide | ChEMBL |
| Melan-a(aa26-35*a27l)) | ChEMBL |
| MPS-21 | ChEMBL |
| Citations |
|---|