EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11N3O |
| Net Charge | 0 |
| Average Mass | 249.273 |
| Monoisotopic Mass | 249.09021 |
| SMILES | Nc1ccc2c(c1)CN1C(=O)c3ccccc3C1=N2 |
| InChI | InChI=1S/C15H11N3O/c16-10-5-6-13-9(7-10)8-18-14(17-13)11-3-1-2-4-12(11)15(18)19/h1-7H,8,16H2 |
| InChIKey | SRIOCKJKFXAKHK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daniquidone (CHEBI:748479) has role antineoplastic agent (CHEBI:35610) |
| daniquidone (CHEBI:748479) is a quinazolines (CHEBI:38530) |
| INNs | Source |
|---|---|
| daniquidona | WHO MedNet |
| daniquidone | WHO MedNet |
| Synonyms | Source |
|---|---|
| Batracylin | ChEMBL |
| BAY H 2049 | ChEMBL |
| BAY-H-2049 | ChEMBL |
| NSC-320846 | ChEMBL |
| Citations |
|---|