EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25NO6S |
| Net Charge | 0 |
| Average Mass | 443.521 |
| Monoisotopic Mass | 443.14026 |
| SMILES | CC(=O)SC[C@@H](Cc1ccc2c(c1)OCO2)C(=O)N[C@@H](C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H25NO6S/c1-15(23(27)28-12-17-6-4-3-5-7-17)24-22(26)19(13-31-16(2)25)10-18-8-9-20-21(11-18)30-14-29-20/h3-9,11,15,19H,10,12-14H2,1-2H3,(H,24,26)/t15-,19+/m0/s1 |
| InChIKey | KKBIUAUSZKGNOA-HNAYVOBHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fasidotril (CHEBI:748469) is a N-acyl-amino acid (CHEBI:51569) |
| INNs | Source |
|---|---|
| fasidotril | WHO MedNet |
| fasidotrilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| Aladotril | ChEMBL |
| Alatriopril | ChEMBL |
| BP-1137 | ChEMBL |
| Citations |
|---|