EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17N3O2S |
| Net Charge | 0 |
| Average Mass | 219.310 |
| Monoisotopic Mass | 219.10415 |
| SMILES | CC(=N)NCCSCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H17N3O2S/c1-6(9)11-3-5-14-4-2-7(10)8(12)13/h7H,2-5,10H2,1H3,(H2,9,11)(H,12,13)/t7-/m0/s1 |
| InChIKey | MOLOJNHYNHBPCW-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | anti-asthmatic agent Any compound that has anti-asthmatic effects. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gw-274150 (CHEBI:748465) has role anti-asthmatic agent (CHEBI:65023) |
| gw-274150 (CHEBI:748465) has role antirheumatic drug (CHEBI:35842) |
| gw-274150 (CHEBI:748465) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Gw-274150 | ChEMBL |
| GW274150 | ChEMBL |
| Citations |
|---|