EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N4OS |
| Net Charge | 0 |
| Average Mass | 284.344 |
| Monoisotopic Mass | 284.07318 |
| SMILES | Cc1ccc2nc(N)nc(=O)c2c1Sc1ccncc1 |
| InChI | InChI=1S/C14H12N4OS/c1-8-2-3-10-11(13(19)18-14(15)17-10)12(8)20-9-4-6-16-7-5-9/h2-7H,1H3,(H3,15,17,18,19) |
| InChIKey | XHWRWCSCBDLOLM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nolatrexed (CHEBI:748463) has role antineoplastic agent (CHEBI:35610) |
| nolatrexed (CHEBI:748463) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| nolatrexed | WHO MedNet |
| Citations |
|---|