EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:74846 - azaserine
| Formula | C5H7N3O4 |
| Net Charge | 0 |
| Average Mass | 173.128 |
| Monoisotopic Mass | 173.04366 |
| SMILES | [N-]=[N+]=CC(=O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H7N3O4/c6-3(5(10)11)2-12-4(9)1-8-7/h1,3H,2,6H2,(H,10,11)/t3-/m0/s1 |
| InChIKey | MZZGOOYMKKIOOX-VKHMYHEASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. glutamine antagonist An antagonist that acts on glutamine receptors. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azaserine (CHEBI:74846) has role antifungal agent (CHEBI:35718) |
| azaserine (CHEBI:74846) has role antimetabolite (CHEBI:35221) |
| azaserine (CHEBI:74846) has role antimicrobial agent (CHEBI:33281) |
| azaserine (CHEBI:74846) has role antineoplastic agent (CHEBI:35610) |
| azaserine (CHEBI:74846) has role glutamine antagonist (CHEBI:138931) |
| azaserine (CHEBI:74846) has role immunosuppressive agent (CHEBI:35705) |
| azaserine (CHEBI:74846) has role metabolite (CHEBI:25212) |
| azaserine (CHEBI:74846) is a L-serine derivative (CHEBI:84135) |
| azaserine (CHEBI:74846) is a carboxylic ester (CHEBI:33308) |
| azaserine (CHEBI:74846) is a diazo compound (CHEBI:39444) |
| azaserine (CHEBI:74846) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| O-(diazoacetyl)-L-serine |
| INNs | Source |
|---|---|
| azaserinum | ChemIDplus |
| azaserina | ChemIDplus |
| azaserine | ChemIDplus |
| azasérine | WHO MedNet |
| Synonyms | Source |
|---|---|
| L-serine diazoacetate ester | ChemIDplus |
| L-serine diazoacetate | ChemIDplus |
| L-azaserine | ChemIDplus |
| L-β-(diazoacetoxy)alanine | ChEBI |
| L-β-(diazoacetoxy)alanin | ChemIDplus |
| Citations |
|---|