EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H23N9O6S |
| Net Charge | 0 |
| Average Mass | 577.583 |
| Monoisotopic Mass | 577.14920 |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccnc(-c3nnnn3)c2)nc1OCCO |
| InChI | InChI=1S/C25H23N9O6S/c1-15-7-8-20(27-14-15)41(36,37)32-24-21(40-19-6-4-3-5-18(19)38-2)25(39-12-11-35)29-22(28-24)16-9-10-26-17(13-16)23-30-33-34-31-23/h3-10,13-14,35H,11-12H2,1-2H3,(H,28,29,32)(H,30,31,33,34) |
| InChIKey | LFWCJABOXHSRGC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clazosentan (CHEBI:748459) has role cardiovascular drug (CHEBI:35554) |
| clazosentan (CHEBI:748459) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| ACT-108475 | ChEMBL |
| Axv-034 | ChEMBL |
| AXV-034343 | ChEMBL |
| AXV-343434 | ChEMBL |
| Clazosentan | ChEMBL |
| Ro 61-1790 | ChEMBL |
| Brand Name | Source |
|---|---|
| Pivlaz | ChEMBL |
| Citations |
|---|