EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H25N3O5 |
| Net Charge | 0 |
| Average Mass | 447.491 |
| Monoisotopic Mass | 447.17942 |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2/C=N/OC(C)(C)C |
| InChI | InChI=1S/C25H25N3O5/c1-5-25(31)18-10-20-21-16(12-28(20)22(29)17(18)13-32-23(25)30)15(11-26-33-24(2,3)4)14-8-6-7-9-19(14)27-21/h6-11,31H,5,12-13H2,1-4H3/b26-11+/t25-/m0/s1 |
| InChIKey | UIVFUQKYVFCEKJ-OPTOVBNMSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gimatecan (CHEBI:748458) has role antineoplastic agent (CHEBI:35610) |
| gimatecan (CHEBI:748458) is a pyranoindolizinoquinoline (CHEBI:48626) |
| INN | Source |
|---|---|
| gimatecan | WHO MedNet |
| Citations |
|---|