EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H31NO3 |
| Net Charge | 0 |
| Average Mass | 453.582 |
| Monoisotopic Mass | 453.23039 |
| SMILES | COc1ccc(C2=C(C(=O)c3ccc(OCCN4CCCC4)cc3)c3ccccc3CC2)cc1 |
| InChI | InChI=1S/C30H31NO3/c1-33-25-13-8-23(9-14-25)28-17-12-22-6-2-3-7-27(22)29(28)30(32)24-10-15-26(16-11-24)34-21-20-31-18-4-5-19-31/h2-3,6-11,13-16H,4-5,12,17-21H2,1H3 |
| InChIKey | IHGLINDYFMDHJG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trioxifene (CHEBI:748452) is a diarylheptanoid (CHEBI:78802) |
| INNs | Source |
|---|---|
| trioxifene | WHO MedNet |
| trioxifeno | WHO MedNet |
| Citations |
|---|